C16H23BN2O2 — CID 168921057
(Z)-3-methylimino-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-1-en-1-amine (PubChem CID 168921057) has the molecular formula C16H23BN2O2 and a molecular weight of 286.18 g/mol. Its IUPAC name is (Z)-3-methylimino-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-1-en-1-amine.
| Compound Name | (Z)-3-methylimino-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 168921057 |
| Molecular Formula | C16H23BN2O2 |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (Z)-3-methylimino-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-1-en-1-amine |
| SMILES | C/N=C/C=C(\N)c1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C16H23BN2O2/c1-15(2)16(3,4)21-17(20-15)13-8-6-7-12(11-13)14(18)9-10-19-5/h6-11H,18H2,1-5H3/b14-9-,19-10+ |
| InChIKey | CDKYKDYGCMTPFU-BUBCDMBBSA-N |
| XLogP | 1.99 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|