C31H43N5O2 — CID 168921862
1-[(Z)-4-[(E)-[(3Z,5E,6Z)-4-amino-5-(cycloprop-2-en-1-ylmethylidene)octa-3,6-dien-2-ylidene]amino]-4-morpholin-4-ylbut-3-en-2-yl]-3-cyclohexa-1,5-dien-1-yl-4-methylpiperazin-2-one (PubChem CID 168921862) has the molecular formula C31H43N5O2 and a molecular weight of 517.72 g/mol. Its IUPAC name is 1-[(Z)-4-[(E)-[(3Z,5E,6Z)-4-amino-5-(cycloprop-2-en-1-ylmethylidene)octa-3,6-dien-2-ylidene]amino]-4-morpholin-4-ylbut-3-en-2-yl]-3-cyclohexa-1,5-dien-1-yl-4-methylpiperazin-2-one.
| Compound Name | 1-[(Z)-4-[(E)-[(3Z,5E,6Z)-4-amino-5-(cycloprop-2-en-1-ylmethylidene)octa-3,6-dien-2-ylidene]amino]-4-morpholin-4-ylbut-3-en-2-yl]-3-cyclohexa-1,5-dien-1-yl-4-methylpiperazin-2-one |
|---|---|
| PubChem CID | 168921862 |
| Molecular Formula | C31H43N5O2 |
| Molecular Weight | 517.72 g/mol |
| Exact Mass | 517.34 |
| IUPAC Name | 1-[(Z)-4-[(E)-[(3Z,5E,6Z)-4-amino-5-(cycloprop-2-en-1-ylmethylidene)octa-3,6-dien-2-ylidene]amino]-4-morpholin-4-ylbut-3-en-2-yl]-3-cyclohexa-1,5-dien-1-yl-4-methylpiperazin-2-one |
| SMILES | C/C=C\C(=C/C1C=C1)\C(N)=C\C(C)=N\C(=C/C(C)N1CCN(C)C(C2=CCCC=C2)C1=O)N1CCOCC1 |
| InChI | InChI=1S/C31H43N5O2/c1-5-9-27(22-25-12-13-25)28(32)20-23(2)33-29(35-16-18-38-19-17-35)21-24(3)36-15-14-34(4)30(31(36)37)26-10-7-6-8-11-26/h5,7,9-13,20-22,24-25,30H,6,8,14-19,32H2,1-4H3/b9-5-,27-22+,28-20-,29-21+,33-23+ |
| InChIKey | UPCLNJDPMHONRU-FQNUBHETSA-N |
| XLogP | 3.96 |
| TPSA | 74.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.72 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|