C26H42N4O — CID 168921921
(2E,3Z,5E)-2-[(Z)-3-[but-3-enyl(propyl)amino]-1-morpholin-4-ylbut-1-enyl]imino-5-[(Z)-prop-1-enyl]octa-3,5,7-trien-4-amine (PubChem CID 168921921) has the molecular formula C26H42N4O and a molecular weight of 426.65 g/mol. Its IUPAC name is (2E,3Z,5E)-2-[(Z)-3-[but-3-enyl(propyl)amino]-1-morpholin-4-ylbut-1-enyl]imino-5-[(Z)-prop-1-enyl]octa-3,5,7-trien-4-amine.
| Compound Name | (2E,3Z,5E)-2-[(Z)-3-[but-3-enyl(propyl)amino]-1-morpholin-4-ylbut-1-enyl]imino-5-[(Z)-prop-1-enyl]octa-3,5,7-trien-4-amine |
|---|---|
| PubChem CID | 168921921 |
| Molecular Formula | C26H42N4O |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.34 |
| IUPAC Name | (2E,3Z,5E)-2-[(Z)-3-[but-3-enyl(propyl)amino]-1-morpholin-4-ylbut-1-enyl]imino-5-[(Z)-prop-1-enyl]octa-3,5,7-trien-4-amine |
| SMILES | C=C/C=C(\C=C/C)C(/N)=C/C(C)=N/C(=C\C(C)N(CCC)CCC=C)N1CCOCC1 |
| InChI | InChI=1S/C26H42N4O/c1-7-11-15-29(14-10-4)23(6)21-26(30-16-18-31-19-17-30)28-22(5)20-25(27)24(12-8-2)13-9-3/h7-9,12-13,20-21,23H,1-2,10-11,14-19,27H2,3-6H3/b13-9-,24-12+,25-20-,26-21+,28-22+ |
| InChIKey | RUHJHQVEUASDJL-BQPNUENHSA-N |
| XLogP | 4.83 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|