About 4-[2-[(1-methylpiperidine-4-carbonyl)amino]-1,3-thiazol-5-yl]benzoic acid
4-[2-[(1-methylpiperidine-4-carbonyl)amino]-1,3-thiazol-5-yl]benzoic acid (PubChem CID 168925345) has the molecular formula C17H19N3O3S
and a molecular weight of 345.42 g/mol. Its IUPAC name is 4-[2-[(1-methylpiperidine-4-carbonyl)amino]-1,3-thiazol-5-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[2-[(1-methylpiperidine-4-carbonyl)amino]-1,3-thiazol-5-yl]benzoic acid |
| PubChem CID | 168925345 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 4-[2-[(1-methylpiperidine-4-carbonyl)amino]-1,3-thiazol-5-yl]benzoic acid |
| SMILES | CN1CCC(C(=O)Nc2ncc(-c3ccc(C(=O)O)cc3)s2)CC1 |
| InChI | InChI=1S/C17H19N3O3S/c1-20-8-6-12(7-9-20)15(21)19-17-18-10-14(24-17)11-2-4-13(5-3-11)16(22)23/h2-5,10,12H,6-9H2,1H3,(H,22,23)(H,18,19,21) |
| InChIKey | YCQRKUJSGVRYRF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-[(1-methylpiperidine-4-carbonyl)amino]-1,3-thiazol-5-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(1-methylpiperidine-4-carbonyl)amino]-1,3-thiazol-5-yl]benzoic acid?
The IUPAC name of 4-[2-[(1-methylpiperidine-4-carbonyl)amino]-1,3-thiazol-5-yl]benzoic acid (CID 168925345) is 4-[2-[(1-methylpiperidine-4-carbonyl)amino]-1,3-thiazol-5-yl]benzoic acid.
What is the SMILES notation for 4-[2-[(1-methylpiperidine-4-carbonyl)amino]-1,3-thiazol-5-yl]benzoic acid?
The canonical SMILES for 4-[2-[(1-methylpiperidine-4-carbonyl)amino]-1,3-thiazol-5-yl]benzoic acid is CN1CCC(C(=O)Nc2ncc(-c3ccc(C(=O)O)cc3)s2)CC1.
What is the InChIKey of 4-[2-[(1-methylpiperidine-4-carbonyl)amino]-1,3-thiazol-5-yl]benzoic acid?
The InChIKey is YCQRKUJSGVRYRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O3S/c1-20-8-6-12(7-9-20)15(21)19-17-18-10-14(24-17)11-2-4-13(5-3-11)16(22)23/h2-5,10,12H,6-9H2,1H3,(H,22,23)(H,18,19,21).
What are the key properties of 4-[2-[(1-methylpiperidine-4-carbonyl)amino]-1,3-thiazol-5-yl]benzoic acid?
4-[2-[(1-methylpiperidine-4-carbonyl)amino]-1,3-thiazol-5-yl]benzoic acid has a molecular weight of 345.42 g/mol, XLogP of 2.79, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(1-methylpiperidine-4-carbonyl)amino]-1,3-thiazol-5-yl]benzoic acid is sourced from PubChem (CID 168925345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).