About ethane;4-methyl-3-propan-2-yl-1,3-dihydropyrazin-2-one
ethane;4-methyl-3-propan-2-yl-1,3-dihydropyrazin-2-one (PubChem CID 168925539) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is ethane;4-methyl-3-propan-2-yl-1,3-dihydropyrazin-2-one.
Molecular Properties
| Compound Name | ethane;4-methyl-3-propan-2-yl-1,3-dihydropyrazin-2-one |
| PubChem CID | 168925539 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | ethane;4-methyl-3-propan-2-yl-1,3-dihydropyrazin-2-one |
| SMILES | CC.CC(C)C1C(=O)NC=CN1C |
| InChI | InChI=1S/C8H14N2O.C2H6/c1-6(2)7-8(11)9-4-5-10(7)3;1-2/h4-7H,1-3H3,(H,9,11);1-2H3 |
| InChIKey | CECWKSJWKQKOMK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-methyl-3-propan-2-yl-1,3-dihydropyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-3-propan-2-yl-1,3-dihydropyrazin-2-one?
The IUPAC name of ethane;4-methyl-3-propan-2-yl-1,3-dihydropyrazin-2-one (CID 168925539) is ethane;4-methyl-3-propan-2-yl-1,3-dihydropyrazin-2-one.
What is the SMILES notation for ethane;4-methyl-3-propan-2-yl-1,3-dihydropyrazin-2-one?
The canonical SMILES for ethane;4-methyl-3-propan-2-yl-1,3-dihydropyrazin-2-one is CC.CC(C)C1C(=O)NC=CN1C.
What is the InChIKey of ethane;4-methyl-3-propan-2-yl-1,3-dihydropyrazin-2-one?
The InChIKey is CECWKSJWKQKOMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O.C2H6/c1-6(2)7-8(11)9-4-5-10(7)3;1-2/h4-7H,1-3H3,(H,9,11);1-2H3.
What are the key properties of ethane;4-methyl-3-propan-2-yl-1,3-dihydropyrazin-2-one?
ethane;4-methyl-3-propan-2-yl-1,3-dihydropyrazin-2-one has a molecular weight of 184.28 g/mol, XLogP of 1.57, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-3-propan-2-yl-1,3-dihydropyrazin-2-one is sourced from PubChem (CID 168925539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).