About 5-isoquinolin-6-yl-1,3-thiazole
5-isoquinolin-6-yl-1,3-thiazole (PubChem CID 168925552) has the molecular formula C12H8N2S
and a molecular weight of 212.28 g/mol. Its IUPAC name is 5-isoquinolin-6-yl-1,3-thiazole.
Molecular Properties
| Compound Name | 5-isoquinolin-6-yl-1,3-thiazole |
| PubChem CID | 168925552 |
| Molecular Formula | C12H8N2S |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 5-isoquinolin-6-yl-1,3-thiazole |
| SMILES | c1cc2cc(-c3cncs3)ccc2cn1 |
| InChI | InChI=1S/C12H8N2S/c1-2-11-6-13-4-3-9(11)5-10(1)12-7-14-8-15-12/h1-8H |
| InChIKey | FZLLZDXEAZJZLX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-isoquinolin-6-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-isoquinolin-6-yl-1,3-thiazole?
The IUPAC name of 5-isoquinolin-6-yl-1,3-thiazole (CID 168925552) is 5-isoquinolin-6-yl-1,3-thiazole.
What is the SMILES notation for 5-isoquinolin-6-yl-1,3-thiazole?
The canonical SMILES for 5-isoquinolin-6-yl-1,3-thiazole is c1cc2cc(-c3cncs3)ccc2cn1.
What is the InChIKey of 5-isoquinolin-6-yl-1,3-thiazole?
The InChIKey is FZLLZDXEAZJZLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2S/c1-2-11-6-13-4-3-9(11)5-10(1)12-7-14-8-15-12/h1-8H.
What are the key properties of 5-isoquinolin-6-yl-1,3-thiazole?
5-isoquinolin-6-yl-1,3-thiazole has a molecular weight of 212.28 g/mol, XLogP of 3.36, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-isoquinolin-6-yl-1,3-thiazole is sourced from PubChem (CID 168925552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).