C10H15F2N — CID 168926091
(3E,5E)-7,7-difluoro-N,6-dimethylocta-1,3,5-trien-4-amine (PubChem CID 168926091) has the molecular formula C10H15F2N and a molecular weight of 187.23 g/mol. Its IUPAC name is (3E,5E)-7,7-difluoro-N,6-dimethylocta-1,3,5-trien-4-amine.
| Compound Name | (3E,5E)-7,7-difluoro-N,6-dimethylocta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 168926091 |
| Molecular Formula | C10H15F2N |
| Molecular Weight | 187.23 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (3E,5E)-7,7-difluoro-N,6-dimethylocta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(\C=C(/C)C(C)(F)F)NC |
| InChI | InChI=1S/C10H15F2N/c1-5-6-9(13-4)7-8(2)10(3,11)12/h5-7,13H,1H2,2-4H3/b8-7+,9-6+ |
| InChIKey | YZOXSXJKKMGIAK-KHHFIZIMSA-N |
| XLogP | 2.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.23 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|