About 2H-1,7-naphthyridin-6-one
2H-1,7-naphthyridin-6-one (PubChem CID 168926721) has the molecular formula C8H6N2O
and a molecular weight of 146.15 g/mol. Its IUPAC name is 2H-1,7-naphthyridin-6-one.
Molecular Properties
| Compound Name | 2H-1,7-naphthyridin-6-one |
| PubChem CID | 168926721 |
| Molecular Formula | C8H6N2O |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | 2H-1,7-naphthyridin-6-one |
| SMILES | O=C1C=C2C=CCN=C2C=N1 |
| InChI | InChI=1S/C8H6N2O/c11-8-4-6-2-1-3-9-7(6)5-10-8/h1-2,4-5H,3H2 |
| InChIKey | QFNKEELBWZHNJZ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-1,7-naphthyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-1,7-naphthyridin-6-one?
The IUPAC name of 2H-1,7-naphthyridin-6-one (CID 168926721) is 2H-1,7-naphthyridin-6-one.
What is the SMILES notation for 2H-1,7-naphthyridin-6-one?
The canonical SMILES for 2H-1,7-naphthyridin-6-one is O=C1C=C2C=CCN=C2C=N1.
What is the InChIKey of 2H-1,7-naphthyridin-6-one?
The InChIKey is QFNKEELBWZHNJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O/c11-8-4-6-2-1-3-9-7(6)5-10-8/h1-2,4-5H,3H2.
What are the key properties of 2H-1,7-naphthyridin-6-one?
2H-1,7-naphthyridin-6-one has a molecular weight of 146.15 g/mol, XLogP of 0.53, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-1,7-naphthyridin-6-one is sourced from PubChem (CID 168926721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).