C27H38FN5O2 — CID 168927256
1-N-(2-cyclopentylethyl)-4-N-[1-[2-(ethylideneamino)-6-fluoro-4-[2-(methylamino)ethoxy]phenyl]ethenyl]benzene-1,4-diamine;formamide (PubChem CID 168927256) has the molecular formula C27H38FN5O2 and a molecular weight of 483.63 g/mol. Its IUPAC name is 1-N-(2-cyclopentylethyl)-4-N-[1-[2-(ethylideneamino)-6-fluoro-4-[2-(methylamino)ethoxy]phenyl]ethenyl]benzene-1,4-diamine;formamide.
| Compound Name | 1-N-(2-cyclopentylethyl)-4-N-[1-[2-(ethylideneamino)-6-fluoro-4-[2-(methylamino)ethoxy]phenyl]ethenyl]benzene-1,4-diamine;formamide |
|---|---|
| PubChem CID | 168927256 |
| Molecular Formula | C27H38FN5O2 |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | 1-N-(2-cyclopentylethyl)-4-N-[1-[2-(ethylideneamino)-6-fluoro-4-[2-(methylamino)ethoxy]phenyl]ethenyl]benzene-1,4-diamine;formamide |
| SMILES | C=C(Nc1ccc(NCCC2CCCC2)cc1)c1c(F)cc(OCCNC)cc1/N=C/C.NC=O |
| InChI | InChI=1S/C26H35FN4O.CH3NO/c1-4-29-25-18-23(32-16-15-28-3)17-24(27)26(25)19(2)31-22-11-9-21(10-12-22)30-14-13-20-7-5-6-8-20;2-1-3/h4,9-12,17-18,20,28,30-31H,2,5-8,13-16H2,1,3H3;1H,(H2,2,3)/b29-4+; |
| InChIKey | HAPFGWJXZUWDMK-XSFPRCONSA-N |
| XLogP | 5.32 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|