C20H24FN3O4S — CID 16892734
N-[2-fluoro-4-[2-(2-phenylmorpholin-4-yl)ethylsulfamoyl]phenyl]acetamide (PubChem CID 16892734) has the molecular formula C20H24FN3O4S and a molecular weight of 421.49 g/mol. Its IUPAC name is N-[2-fluoro-4-[2-(2-phenylmorpholin-4-yl)ethylsulfamoyl]phenyl]acetamide.
| Compound Name | N-[2-fluoro-4-[2-(2-phenylmorpholin-4-yl)ethylsulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 16892734 |
| Molecular Formula | C20H24FN3O4S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-[2-fluoro-4-[2-(2-phenylmorpholin-4-yl)ethylsulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCCN2CCOC(c3ccccc3)C2)cc1F |
| InChI | InChI=1S/C20H24FN3O4S/c1-15(25)23-19-8-7-17(13-18(19)21)29(26,27)22-9-10-24-11-12-28-20(14-24)16-5-3-2-4-6-16/h2-8,13,20,22H,9-12,14H2,1H3,(H,23,25) |
| InChIKey | ZRQRGEQHHDLQOF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |