C17H13ClF2N6O — CID 168927897
5-[2-[5-chloro-1-(2,2-difluorocyclopropyl)indazol-4-yl]ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide (PubChem CID 168927897) has the molecular formula C17H13ClF2N6O and a molecular weight of 390.78 g/mol. Its IUPAC name is 5-[2-[5-chloro-1-(2,2-difluorocyclopropyl)indazol-4-yl]ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[2-[5-chloro-1-(2,2-difluorocyclopropyl)indazol-4-yl]ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 168927897 |
| Molecular Formula | C17H13ClF2N6O |
| Molecular Weight | 390.78 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 5-[2-[5-chloro-1-(2,2-difluorocyclopropyl)indazol-4-yl]ethynyl]-3-(methylamino)-1H-pyrazole-4-carboxamide |
| SMILES | CNc1n[nH]c(C#Cc2c(Cl)ccc3c2cnn3C2CC2(F)F)c1C(N)=O |
| InChI | InChI=1S/C17H13ClF2N6O/c1-22-16-14(15(21)27)11(24-25-16)4-2-8-9-7-23-26(13-6-17(13,19)20)12(9)5-3-10(8)18/h3,5,7,13H,6H2,1H3,(H2,21,27)(H2,22,24,25) |
| InChIKey | SFEIYLZLNUDNMO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.78 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|