C15H19F3N2 — CID 168928304
2-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-1-propan-2-yl-4-(trifluoromethyl)imidazole (PubChem CID 168928304) has the molecular formula C15H19F3N2 and a molecular weight of 284.33 g/mol. Its IUPAC name is 2-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-1-propan-2-yl-4-(trifluoromethyl)imidazole.
| Compound Name | 2-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-1-propan-2-yl-4-(trifluoromethyl)imidazole |
|---|---|
| PubChem CID | 168928304 |
| Molecular Formula | C15H19F3N2 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-1-propan-2-yl-4-(trifluoromethyl)imidazole |
| SMILES | C=C(C)/C=C\C(=C/C)c1nc(C(F)(F)F)cn1C(C)C |
| InChI | InChI=1S/C15H19F3N2/c1-6-12(8-7-10(2)3)14-19-13(15(16,17)18)9-20(14)11(4)5/h6-9,11H,2H2,1,3-5H3/b8-7-,12-6+ |
| InChIKey | FLCCNLHMNFYPIK-HRZQEMGZSA-N |
| XLogP | 5.02 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|