About 2-methyl-4-(3-methylbutyl)-1,5-dihydropyrazole
2-methyl-4-(3-methylbutyl)-1,5-dihydropyrazole (PubChem CID 168928486) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 2-methyl-4-(3-methylbutyl)-1,5-dihydropyrazole.
Molecular Properties
| Compound Name | 2-methyl-4-(3-methylbutyl)-1,5-dihydropyrazole |
| PubChem CID | 168928486 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 2-methyl-4-(3-methylbutyl)-1,5-dihydropyrazole |
| SMILES | CC(C)CCC1=CN(C)NC1 |
| InChI | InChI=1S/C9H18N2/c1-8(2)4-5-9-6-10-11(3)7-9/h7-8,10H,4-6H2,1-3H3 |
| InChIKey | FNELDSWNGJCWOC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-4-(3-methylbutyl)-1,5-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(3-methylbutyl)-1,5-dihydropyrazole?
The IUPAC name of 2-methyl-4-(3-methylbutyl)-1,5-dihydropyrazole (CID 168928486) is 2-methyl-4-(3-methylbutyl)-1,5-dihydropyrazole.
What is the SMILES notation for 2-methyl-4-(3-methylbutyl)-1,5-dihydropyrazole?
The canonical SMILES for 2-methyl-4-(3-methylbutyl)-1,5-dihydropyrazole is CC(C)CCC1=CN(C)NC1.
What is the InChIKey of 2-methyl-4-(3-methylbutyl)-1,5-dihydropyrazole?
The InChIKey is FNELDSWNGJCWOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-8(2)4-5-9-6-10-11(3)7-9/h7-8,10H,4-6H2,1-3H3.
What are the key properties of 2-methyl-4-(3-methylbutyl)-1,5-dihydropyrazole?
2-methyl-4-(3-methylbutyl)-1,5-dihydropyrazole has a molecular weight of 154.26 g/mol, XLogP of 1.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(3-methylbutyl)-1,5-dihydropyrazole is sourced from PubChem (CID 168928486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).