C22H30N2O3S — CID 16892892
2-phenyl-N-[4-(2-phenylmorpholin-4-yl)butyl]ethanesulfonamide (PubChem CID 16892892) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is 2-phenyl-N-[4-(2-phenylmorpholin-4-yl)butyl]ethanesulfonamide.
| Compound Name | 2-phenyl-N-[4-(2-phenylmorpholin-4-yl)butyl]ethanesulfonamide |
|---|---|
| PubChem CID | 16892892 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 2-phenyl-N-[4-(2-phenylmorpholin-4-yl)butyl]ethanesulfonamide |
| SMILES | O=S(=O)(CCc1ccccc1)NCCCCN1CCOC(c2ccccc2)C1 |
| InChI | InChI=1S/C22H30N2O3S/c25-28(26,18-13-20-9-3-1-4-10-20)23-14-7-8-15-24-16-17-27-22(19-24)21-11-5-2-6-12-21/h1-6,9-12,22-23H,7-8,13-19H2 |
| InChIKey | LSMGRCZFPOXNIZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|