C31H37BN4O3 — CID 168929517
2-(2-cyanopropan-2-yl)-N-[6-methyl-5-[3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]pyridine-4-carboxamide (PubChem CID 168929517) has the molecular formula C31H37BN4O3 and a molecular weight of 524.47 g/mol. Its IUPAC name is 2-(2-cyanopropan-2-yl)-N-[6-methyl-5-[3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]pyridine-4-carboxamide.
| Compound Name | 2-(2-cyanopropan-2-yl)-N-[6-methyl-5-[3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 168929517 |
| Molecular Formula | C31H37BN4O3 |
| Molecular Weight | 524.47 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | 2-(2-cyanopropan-2-yl)-N-[6-methyl-5-[3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]pyridine-4-carboxamide |
| SMILES | Cc1ncc(NC(=O)c2ccnc(C(C)(C)C#N)c2)cc1-c1cc(B2OC(C)(C)C(C)(C)O2)cc(C(C)C)c1 |
| InChI | InChI=1S/C31H37BN4O3/c1-19(2)22-12-23(14-24(13-22)32-38-30(6,7)31(8,9)39-32)26-16-25(17-35-20(26)3)36-28(37)21-10-11-34-27(15-21)29(4,5)18-33/h10-17,19H,1-9H3,(H,36,37) |
| InChIKey | MZPSJPKLUJOIDJ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.47 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|