C16H30N2O — CID 168930336
ethane;N-(oxetan-3-ylmethyl)-4-propan-2-ylpyridin-2-amine (PubChem CID 168930336) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is ethane;N-(oxetan-3-ylmethyl)-4-propan-2-ylpyridin-2-amine.
| Compound Name | ethane;N-(oxetan-3-ylmethyl)-4-propan-2-ylpyridin-2-amine |
|---|---|
| PubChem CID | 168930336 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | ethane;N-(oxetan-3-ylmethyl)-4-propan-2-ylpyridin-2-amine |
| SMILES | CC.CC.CC(C)c1ccnc(NCC2COC2)c1 |
| InChI | InChI=1S/C12H18N2O.2C2H6/c1-9(2)11-3-4-13-12(5-11)14-6-10-7-15-8-10;2*1-2/h3-5,9-10H,6-8H2,1-2H3,(H,13,14);2*1-2H3 |
| InChIKey | YVQMLJXKCZXSRL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |