About (E)-3-amino-2-(2,2,2-trifluoroethyliminomethyl)prop-2-enal
(E)-3-amino-2-(2,2,2-trifluoroethyliminomethyl)prop-2-enal (PubChem CID 168930680) has the molecular formula C6H7F3N2O
and a molecular weight of 180.13 g/mol. Its IUPAC name is (E)-3-amino-2-(2,2,2-trifluoroethyliminomethyl)prop-2-enal.
Molecular Properties
| Compound Name | (E)-3-amino-2-(2,2,2-trifluoroethyliminomethyl)prop-2-enal |
| PubChem CID | 168930680 |
| Molecular Formula | C6H7F3N2O |
| Molecular Weight | 180.13 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | (E)-3-amino-2-(2,2,2-trifluoroethyliminomethyl)prop-2-enal |
| SMILES | N/C=C(C=O)\C=N\CC(F)(F)F |
| InChI | InChI=1S/C6H7F3N2O/c7-6(8,9)4-11-2-5(1-10)3-12/h1-3H,4,10H2/b5-1+,11-2+ |
| InChIKey | UPZLBJVAXHKMIN-JJDPJMAVSA-N |
| XLogP | 0.66 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.13 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-amino-2-(2,2,2-trifluoroethyliminomethyl)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-amino-2-(2,2,2-trifluoroethyliminomethyl)prop-2-enal?
The IUPAC name of (E)-3-amino-2-(2,2,2-trifluoroethyliminomethyl)prop-2-enal (CID 168930680) is (E)-3-amino-2-(2,2,2-trifluoroethyliminomethyl)prop-2-enal.
What is the SMILES notation for (E)-3-amino-2-(2,2,2-trifluoroethyliminomethyl)prop-2-enal?
The canonical SMILES for (E)-3-amino-2-(2,2,2-trifluoroethyliminomethyl)prop-2-enal is N/C=C(C=O)\C=N\CC(F)(F)F.
What is the InChIKey of (E)-3-amino-2-(2,2,2-trifluoroethyliminomethyl)prop-2-enal?
The InChIKey is UPZLBJVAXHKMIN-JJDPJMAVSA-N. The full InChI is InChI=1S/C6H7F3N2O/c7-6(8,9)4-11-2-5(1-10)3-12/h1-3H,4,10H2/b5-1+,11-2+.
What are the key properties of (E)-3-amino-2-(2,2,2-trifluoroethyliminomethyl)prop-2-enal?
(E)-3-amino-2-(2,2,2-trifluoroethyliminomethyl)prop-2-enal has a molecular weight of 180.13 g/mol, XLogP of 0.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-amino-2-(2,2,2-trifluoroethyliminomethyl)prop-2-enal is sourced from PubChem (CID 168930680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).