C23H27N3O5 — CID 16893069
methyl 4-[[2-oxo-2-[3-(2-phenylmorpholin-4-yl)propylamino]acetyl]amino]benzoate (PubChem CID 16893069) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is methyl 4-[[2-oxo-2-[3-(2-phenylmorpholin-4-yl)propylamino]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-oxo-2-[3-(2-phenylmorpholin-4-yl)propylamino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 16893069 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | methyl 4-[[2-oxo-2-[3-(2-phenylmorpholin-4-yl)propylamino]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C(=O)NCCCN2CCOC(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C23H27N3O5/c1-30-23(29)18-8-10-19(11-9-18)25-22(28)21(27)24-12-5-13-26-14-15-31-20(16-26)17-6-3-2-4-7-17/h2-4,6-11,20H,5,12-16H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | GCBYJZKXUCEMAR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|