C12H17NO2S — CID 168930817
4-[(1-aminocyclopropyl)methyl]-2,5-dimethoxybenzenethiol (PubChem CID 168930817) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 4-[(1-aminocyclopropyl)methyl]-2,5-dimethoxybenzenethiol.
| Compound Name | 4-[(1-aminocyclopropyl)methyl]-2,5-dimethoxybenzenethiol |
|---|---|
| PubChem CID | 168930817 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 4-[(1-aminocyclopropyl)methyl]-2,5-dimethoxybenzenethiol |
| SMILES | COc1cc(CC2(N)CC2)c(OC)cc1S |
| InChI | InChI=1S/C12H17NO2S/c1-14-9-6-11(16)10(15-2)5-8(9)7-12(13)3-4-12/h5-6,16H,3-4,7,13H2,1-2H3 |
| InChIKey | MSZUQAOPAIACNS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|