About 4-[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]-2,2-dimethyl-4-oxobutanoic acid
4-[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 168930906) has the molecular formula C19H26N2O4
and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]-2,2-dimethyl-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]-2,2-dimethyl-4-oxobutanoic acid |
| PubChem CID | 168930906 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 4-[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]-2,2-dimethyl-4-oxobutanoic acid |
| SMILES | COc1ccc2c(CCN(C)C)cn(C(=O)CC(C)(C)C(=O)O)c2c1 |
| InChI | InChI=1S/C19H26N2O4/c1-19(2,18(23)24)11-17(22)21-12-13(8-9-20(3)4)15-7-6-14(25-5)10-16(15)21/h6-7,10,12H,8-9,11H2,1-5H3,(H,23,24) |
| InChIKey | LYNFHJBKTYBELZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]-2,2-dimethyl-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]-2,2-dimethyl-4-oxobutanoic acid?
The IUPAC name of 4-[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]-2,2-dimethyl-4-oxobutanoic acid (CID 168930906) is 4-[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]-2,2-dimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]-2,2-dimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]-2,2-dimethyl-4-oxobutanoic acid is COc1ccc2c(CCN(C)C)cn(C(=O)CC(C)(C)C(=O)O)c2c1.
What is the InChIKey of 4-[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]-2,2-dimethyl-4-oxobutanoic acid?
The InChIKey is LYNFHJBKTYBELZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O4/c1-19(2,18(23)24)11-17(22)21-12-13(8-9-20(3)4)15-7-6-14(25-5)10-16(15)21/h6-7,10,12H,8-9,11H2,1-5H3,(H,23,24).
What are the key properties of 4-[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]-2,2-dimethyl-4-oxobutanoic acid?
4-[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]-2,2-dimethyl-4-oxobutanoic acid has a molecular weight of 346.43 g/mol, XLogP of 2.90, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]-2,2-dimethyl-4-oxobutanoic acid is sourced from PubChem (CID 168930906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).