C35H36F3N7O3 — CID 168931653
2-[[2-[2-methoxy-4-[[3-(1-prop-2-enoylpiperidin-3-yl)anilino]methyl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N-methylbenzamide (PubChem CID 168931653) has the molecular formula C35H36F3N7O3 and a molecular weight of 659.71 g/mol. Its IUPAC name is 2-[[2-[2-methoxy-4-[[3-(1-prop-2-enoylpiperidin-3-yl)anilino]methyl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N-methylbenzamide.
| Compound Name | 2-[[2-[2-methoxy-4-[[3-(1-prop-2-enoylpiperidin-3-yl)anilino]methyl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 168931653 |
| Molecular Formula | C35H36F3N7O3 |
| Molecular Weight | 659.71 g/mol |
| Exact Mass | 659.28 |
| IUPAC Name | 2-[[2-[2-methoxy-4-[[3-(1-prop-2-enoylpiperidin-3-yl)anilino]methyl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N-methylbenzamide |
| SMILES | C=CC(=O)N1CCCC(c2cccc(NCc3ccc(Nc4ncc(C(F)(F)F)c(Nc5ccccc5C(=O)NC)n4)c(OC)c3)c2)C1 |
| InChI | InChI=1S/C35H36F3N7O3/c1-4-31(46)45-16-8-10-24(21-45)23-9-7-11-25(18-23)40-19-22-14-15-29(30(17-22)48-3)43-34-41-20-27(35(36,37)38)32(44-34)42-28-13-6-5-12-26(28)33(47)39-2/h4-7,9,11-15,17-18,20,24,40H,1,8,10,16,19,21H2,2-3H3,(H,39,47)(H2,41,42,43,44) |
| InChIKey | ITLACNNTWFCKLH-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 120.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.71 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|