About 7-chloro-3-(difluoromethyl)-1-[(3R)-oxolan-3-yl]oxy-2,6-naphthyridine
7-chloro-3-(difluoromethyl)-1-[(3R)-oxolan-3-yl]oxy-2,6-naphthyridine (PubChem CID 168932255) has the molecular formula C13H11ClF2N2O2
and a molecular weight of 300.69 g/mol. Its IUPAC name is 7-chloro-3-(difluoromethyl)-1-[(3R)-oxolan-3-yl]oxy-2,6-naphthyridine.
Molecular Properties
| Compound Name | 7-chloro-3-(difluoromethyl)-1-[(3R)-oxolan-3-yl]oxy-2,6-naphthyridine |
| PubChem CID | 168932255 |
| Molecular Formula | C13H11ClF2N2O2 |
| Molecular Weight | 300.69 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 7-chloro-3-(difluoromethyl)-1-[(3R)-oxolan-3-yl]oxy-2,6-naphthyridine |
| SMILES | FC(F)c1cc2cnc(Cl)cc2c(O[C@@H]2CCOC2)n1 |
| InChI | InChI=1S/C13H11ClF2N2O2/c14-11-4-9-7(5-17-11)3-10(12(15)16)18-13(9)20-8-1-2-19-6-8/h3-5,8,12H,1-2,6H2/t8-/m1/s1 |
| InChIKey | NXIPFRWAGKFYBV-MRVPVSSYSA-N |
| XLogP | 3.39 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.69 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-3-(difluoromethyl)-1-[(3R)-oxolan-3-yl]oxy-2,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3-(difluoromethyl)-1-[(3R)-oxolan-3-yl]oxy-2,6-naphthyridine?
The IUPAC name of 7-chloro-3-(difluoromethyl)-1-[(3R)-oxolan-3-yl]oxy-2,6-naphthyridine (CID 168932255) is 7-chloro-3-(difluoromethyl)-1-[(3R)-oxolan-3-yl]oxy-2,6-naphthyridine.
What is the SMILES notation for 7-chloro-3-(difluoromethyl)-1-[(3R)-oxolan-3-yl]oxy-2,6-naphthyridine?
The canonical SMILES for 7-chloro-3-(difluoromethyl)-1-[(3R)-oxolan-3-yl]oxy-2,6-naphthyridine is FC(F)c1cc2cnc(Cl)cc2c(O[C@@H]2CCOC2)n1.
What is the InChIKey of 7-chloro-3-(difluoromethyl)-1-[(3R)-oxolan-3-yl]oxy-2,6-naphthyridine?
The InChIKey is NXIPFRWAGKFYBV-MRVPVSSYSA-N. The full InChI is InChI=1S/C13H11ClF2N2O2/c14-11-4-9-7(5-17-11)3-10(12(15)16)18-13(9)20-8-1-2-19-6-8/h3-5,8,12H,1-2,6H2/t8-/m1/s1.
What are the key properties of 7-chloro-3-(difluoromethyl)-1-[(3R)-oxolan-3-yl]oxy-2,6-naphthyridine?
7-chloro-3-(difluoromethyl)-1-[(3R)-oxolan-3-yl]oxy-2,6-naphthyridine has a molecular weight of 300.69 g/mol, XLogP of 3.39, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3-(difluoromethyl)-1-[(3R)-oxolan-3-yl]oxy-2,6-naphthyridine is sourced from PubChem (CID 168932255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).