C9H15NS — CID 168932464
(2E,4Z)-N,3-dimethyl-5-methylsulfanylhexa-2,4-dien-1-imine (PubChem CID 168932464) has the molecular formula C9H15NS and a molecular weight of 169.29 g/mol. Its IUPAC name is (2E,4Z)-N,3-dimethyl-5-methylsulfanylhexa-2,4-dien-1-imine.
| Compound Name | (2E,4Z)-N,3-dimethyl-5-methylsulfanylhexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 168932464 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (2E,4Z)-N,3-dimethyl-5-methylsulfanylhexa-2,4-dien-1-imine |
| SMILES | C/N=C/C=C(C)/C=C(/C)SC |
| InChI | InChI=1S/C9H15NS/c1-8(5-6-10-3)7-9(2)11-4/h5-7H,1-4H3/b8-5+,9-7-,10-6+ |
| InChIKey | QFAWSIOVISACLR-ZNZWULBLSA-N |
| XLogP | 2.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|