About 6-methyl-4,5-dihydro-1H-azepine-2-thiol
6-methyl-4,5-dihydro-1H-azepine-2-thiol (PubChem CID 168932502) has the molecular formula C7H11NS
and a molecular weight of 141.24 g/mol. Its IUPAC name is 6-methyl-4,5-dihydro-1H-azepine-2-thiol.
Molecular Properties
| Compound Name | 6-methyl-4,5-dihydro-1H-azepine-2-thiol |
| PubChem CID | 168932502 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 6-methyl-4,5-dihydro-1H-azepine-2-thiol |
| SMILES | CC1=CNC(S)=CCC1 |
| InChI | InChI=1S/C7H11NS/c1-6-3-2-4-7(9)8-5-6/h4-5,8-9H,2-3H2,1H3 |
| InChIKey | KOBVWNKQWRDGJW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-4,5-dihydro-1H-azepine-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4,5-dihydro-1H-azepine-2-thiol?
The IUPAC name of 6-methyl-4,5-dihydro-1H-azepine-2-thiol (CID 168932502) is 6-methyl-4,5-dihydro-1H-azepine-2-thiol.
What is the SMILES notation for 6-methyl-4,5-dihydro-1H-azepine-2-thiol?
The canonical SMILES for 6-methyl-4,5-dihydro-1H-azepine-2-thiol is CC1=CNC(S)=CCC1.
What is the InChIKey of 6-methyl-4,5-dihydro-1H-azepine-2-thiol?
The InChIKey is KOBVWNKQWRDGJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NS/c1-6-3-2-4-7(9)8-5-6/h4-5,8-9H,2-3H2,1H3.
What are the key properties of 6-methyl-4,5-dihydro-1H-azepine-2-thiol?
6-methyl-4,5-dihydro-1H-azepine-2-thiol has a molecular weight of 141.24 g/mol, XLogP of 2.04, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4,5-dihydro-1H-azepine-2-thiol is sourced from PubChem (CID 168932502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).