C12H14N2 — CID 168932557
(4aZ,9Z)-5-methyl-7,8-dihydro-6H-pyrido[2,3-b]azonine (PubChem CID 168932557) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is (4aZ,9Z)-5-methyl-7,8-dihydro-6H-pyrido[2,3-b]azonine.
| Compound Name | (4aZ,9Z)-5-methyl-7,8-dihydro-6H-pyrido[2,3-b]azonine |
|---|---|
| PubChem CID | 168932557 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | (4aZ,9Z)-5-methyl-7,8-dihydro-6H-pyrido[2,3-b]azonine |
| SMILES | C/C1=c2\cccn\c2=N\C=C/CCC1 |
| InChI | InChI=1S/C12H14N2/c1-10-6-3-2-4-8-13-12-11(10)7-5-9-14-12/h4-5,7-9H,2-3,6H2,1H3/b8-4-,11-10-,13-12+ |
| InChIKey | TWCALGWDLSXDSB-FREYKWCISA-N |
| XLogP | 1.57 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |