About acetylene;1-[(Z)-1,1-difluorobut-2-en-2-yl]-1-propan-2-ylhydrazine
acetylene;1-[(Z)-1,1-difluorobut-2-en-2-yl]-1-propan-2-ylhydrazine (PubChem CID 168933133) has the molecular formula C9H16F2N2
and a molecular weight of 190.24 g/mol. Its IUPAC name is acetylene;1-[(Z)-1,1-difluorobut-2-en-2-yl]-1-propan-2-ylhydrazine.
Molecular Properties
| Compound Name | acetylene;1-[(Z)-1,1-difluorobut-2-en-2-yl]-1-propan-2-ylhydrazine |
| PubChem CID | 168933133 |
| Molecular Formula | C9H16F2N2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | acetylene;1-[(Z)-1,1-difluorobut-2-en-2-yl]-1-propan-2-ylhydrazine |
| SMILES | C#C.C/C=C(/C(F)F)N(N)C(C)C |
| InChI | InChI=1S/C7H14F2N2.C2H2/c1-4-6(7(8)9)11(10)5(2)3;1-2/h4-5,7H,10H2,1-3H3;1-2H/b6-4-; |
| InChIKey | GSSFOVGNBSFVNF-YHSAGPEESA-N |
| XLogP | 1.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;1-[(Z)-1,1-difluorobut-2-en-2-yl]-1-propan-2-ylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;1-[(Z)-1,1-difluorobut-2-en-2-yl]-1-propan-2-ylhydrazine?
The IUPAC name of acetylene;1-[(Z)-1,1-difluorobut-2-en-2-yl]-1-propan-2-ylhydrazine (CID 168933133) is acetylene;1-[(Z)-1,1-difluorobut-2-en-2-yl]-1-propan-2-ylhydrazine.
What is the SMILES notation for acetylene;1-[(Z)-1,1-difluorobut-2-en-2-yl]-1-propan-2-ylhydrazine?
The canonical SMILES for acetylene;1-[(Z)-1,1-difluorobut-2-en-2-yl]-1-propan-2-ylhydrazine is C#C.C/C=C(/C(F)F)N(N)C(C)C.
What is the InChIKey of acetylene;1-[(Z)-1,1-difluorobut-2-en-2-yl]-1-propan-2-ylhydrazine?
The InChIKey is GSSFOVGNBSFVNF-YHSAGPEESA-N. The full InChI is InChI=1S/C7H14F2N2.C2H2/c1-4-6(7(8)9)11(10)5(2)3;1-2/h4-5,7H,10H2,1-3H3;1-2H/b6-4-;.
What are the key properties of acetylene;1-[(Z)-1,1-difluorobut-2-en-2-yl]-1-propan-2-ylhydrazine?
acetylene;1-[(Z)-1,1-difluorobut-2-en-2-yl]-1-propan-2-ylhydrazine has a molecular weight of 190.24 g/mol, XLogP of 1.99, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;1-[(Z)-1,1-difluorobut-2-en-2-yl]-1-propan-2-ylhydrazine is sourced from PubChem (CID 168933133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).