C31H21N3O — CID 168933424
6-phenyl-6,15,25-triazaheptacyclo[15.11.0.02,14.05,13.07,12.018,26.019,24]octacosa-1(17),2(14),3,5(13),8,10,18(26),19,21,23,27-undecaen-16-one (PubChem CID 168933424) has the molecular formula C31H21N3O and a molecular weight of 451.53 g/mol. Its IUPAC name is 6-phenyl-6,15,25-triazaheptacyclo[15.11.0.02,14.05,13.07,12.018,26.019,24]octacosa-1(17),2(14),3,5(13),8,10,18(26),19,21,23,27-undecaen-16-one.
| Compound Name | 6-phenyl-6,15,25-triazaheptacyclo[15.11.0.02,14.05,13.07,12.018,26.019,24]octacosa-1(17),2(14),3,5(13),8,10,18(26),19,21,23,27-undecaen-16-one |
|---|---|
| PubChem CID | 168933424 |
| Molecular Formula | C31H21N3O |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 6-phenyl-6,15,25-triazaheptacyclo[15.11.0.02,14.05,13.07,12.018,26.019,24]octacosa-1(17),2(14),3,5(13),8,10,18(26),19,21,23,27-undecaen-16-one |
| SMILES | O=c1[nH]c2c3c(ccc2c2ccc4[nH]c5ccccc5c4c12)N(c1ccccc1)C1C=CC=CC31 |
| InChI | InChI=1S/C31H21N3O/c35-31-29-19(14-16-24-27(29)21-10-4-6-12-23(21)32-24)20-15-17-26-28(30(20)33-31)22-11-5-7-13-25(22)34(26)18-8-2-1-3-9-18/h1-17,22,25,32H,(H,33,35) |
| InChIKey | BSZTUFQJZGZKKV-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 51.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|