C24H30F3N7O — CID 168933722
N-[[6-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-4-(trifluoromethyl)-2-pyridinyl]methyl]-5-(oxan-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 168933722) has the molecular formula C24H30F3N7O and a molecular weight of 489.55 g/mol. Its IUPAC name is N-[[6-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-4-(trifluoromethyl)-2-pyridinyl]methyl]-5-(oxan-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | N-[[6-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-4-(trifluoromethyl)-2-pyridinyl]methyl]-5-(oxan-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 168933722 |
| Molecular Formula | C24H30F3N7O |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | N-[[6-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-4-(trifluoromethyl)-2-pyridinyl]methyl]-5-(oxan-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | C[C@@H]1CN(c2cc(C(F)(F)F)cc(CNc3ncnn4ccc(C5CCOCC5)c34)n2)C[C@H](C)N1 |
| InChI | InChI=1S/C24H30F3N7O/c1-15-12-33(13-16(2)31-15)21-10-18(24(25,26)27)9-19(32-21)11-28-23-22-20(17-4-7-35-8-5-17)3-6-34(22)30-14-29-23/h3,6,9-10,14-17,31H,4-5,7-8,11-13H2,1-2H3,(H,28,29,30)/t15-,16+ |
| InChIKey | WOZDPWXFRUSDCG-IYBDPMFKSA-N |
| XLogP | 3.84 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |