C23H20F2N4O2S — CID 168933997
[5-(2,4-difluorophenyl)-1,2-oxazol-3-yl]-[4-(1,3,5-trimethylpyrazol-4-yl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]methanone (PubChem CID 168933997) has the molecular formula C23H20F2N4O2S and a molecular weight of 454.50 g/mol. Its IUPAC name is [5-(2,4-difluorophenyl)-1,2-oxazol-3-yl]-[4-(1,3,5-trimethylpyrazol-4-yl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]methanone.
| Compound Name | [5-(2,4-difluorophenyl)-1,2-oxazol-3-yl]-[4-(1,3,5-trimethylpyrazol-4-yl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]methanone |
|---|---|
| PubChem CID | 168933997 |
| Molecular Formula | C23H20F2N4O2S |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | [5-(2,4-difluorophenyl)-1,2-oxazol-3-yl]-[4-(1,3,5-trimethylpyrazol-4-yl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]methanone |
| SMILES | Cc1nn(C)c(C)c1C1CN(C(=O)c2cc(-c3ccc(F)cc3F)on2)Cc2sccc21 |
| InChI | InChI=1S/C23H20F2N4O2S/c1-12-22(13(2)28(3)26-12)17-10-29(11-21-15(17)6-7-32-21)23(30)19-9-20(31-27-19)16-5-4-14(24)8-18(16)25/h4-9,17H,10-11H2,1-3H3 |
| InChIKey | DWEQLZGDCOCFCU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 64.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |