C10H16F3N — CID 168934137
ethane;(Z)-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]but-2-en-1-imine (PubChem CID 168934137) has the molecular formula C10H16F3N and a molecular weight of 207.24 g/mol. Its IUPAC name is ethane;(Z)-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]but-2-en-1-imine.
| Compound Name | ethane;(Z)-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]but-2-en-1-imine |
|---|---|
| PubChem CID | 168934137 |
| Molecular Formula | C10H16F3N |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | ethane;(Z)-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]but-2-en-1-imine |
| SMILES | C/C=C\C=N\C(=C/C)C(F)(F)F.CC |
| InChI | InChI=1S/C8H10F3N.C2H6/c1-3-5-6-12-7(4-2)8(9,10)11;1-2/h3-6H,1-2H3;1-2H3/b5-3-,7-4-,12-6+; |
| InChIKey | PCZRQLYQWCJWCK-IZZZXHERSA-N |
| XLogP | 4.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|