About 2-amino-2-(4,4-difluorocyclohexyl)acetaldehyde
2-amino-2-(4,4-difluorocyclohexyl)acetaldehyde (PubChem CID 168935659) has the molecular formula C8H13F2NO
and a molecular weight of 177.19 g/mol. Its IUPAC name is 2-amino-2-(4,4-difluorocyclohexyl)acetaldehyde.
Molecular Properties
| Compound Name | 2-amino-2-(4,4-difluorocyclohexyl)acetaldehyde |
| PubChem CID | 168935659 |
| Molecular Formula | C8H13F2NO |
| Molecular Weight | 177.19 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 2-amino-2-(4,4-difluorocyclohexyl)acetaldehyde |
| SMILES | NC(C=O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C8H13F2NO/c9-8(10)3-1-6(2-4-8)7(11)5-12/h5-7H,1-4,11H2 |
| InChIKey | WCQJFOBXKHPWOQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.19 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-(4,4-difluorocyclohexyl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(4,4-difluorocyclohexyl)acetaldehyde?
The IUPAC name of 2-amino-2-(4,4-difluorocyclohexyl)acetaldehyde (CID 168935659) is 2-amino-2-(4,4-difluorocyclohexyl)acetaldehyde.
What is the SMILES notation for 2-amino-2-(4,4-difluorocyclohexyl)acetaldehyde?
The canonical SMILES for 2-amino-2-(4,4-difluorocyclohexyl)acetaldehyde is NC(C=O)C1CCC(F)(F)CC1.
What is the InChIKey of 2-amino-2-(4,4-difluorocyclohexyl)acetaldehyde?
The InChIKey is WCQJFOBXKHPWOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2NO/c9-8(10)3-1-6(2-4-8)7(11)5-12/h5-7H,1-4,11H2.
What are the key properties of 2-amino-2-(4,4-difluorocyclohexyl)acetaldehyde?
2-amino-2-(4,4-difluorocyclohexyl)acetaldehyde has a molecular weight of 177.19 g/mol, XLogP of 1.34, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(4,4-difluorocyclohexyl)acetaldehyde is sourced from PubChem (CID 168935659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).