About 3-[(2S)-1,1-difluoropropan-2-yl]-5-fluoro-1H-pyridin-2-one
3-[(2S)-1,1-difluoropropan-2-yl]-5-fluoro-1H-pyridin-2-one (PubChem CID 168935765) has the molecular formula C8H8F3NO
and a molecular weight of 191.15 g/mol. Its IUPAC name is 3-[(2S)-1,1-difluoropropan-2-yl]-5-fluoro-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3-[(2S)-1,1-difluoropropan-2-yl]-5-fluoro-1H-pyridin-2-one |
| PubChem CID | 168935765 |
| Molecular Formula | C8H8F3NO |
| Molecular Weight | 191.15 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 3-[(2S)-1,1-difluoropropan-2-yl]-5-fluoro-1H-pyridin-2-one |
| SMILES | C[C@@H](c1cc(F)c[nH]c1=O)C(F)F |
| InChI | InChI=1S/C8H8F3NO/c1-4(7(10)11)6-2-5(9)3-12-8(6)13/h2-4,7H,1H3,(H,12,13)/t4-/m0/s1 |
| InChIKey | BMCQKJSXEBSKMO-BYPYZUCNSA-N |
| XLogP | 1.88 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.15 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[(2S)-1,1-difluoropropan-2-yl]-5-fluoro-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S)-1,1-difluoropropan-2-yl]-5-fluoro-1H-pyridin-2-one?
The IUPAC name of 3-[(2S)-1,1-difluoropropan-2-yl]-5-fluoro-1H-pyridin-2-one (CID 168935765) is 3-[(2S)-1,1-difluoropropan-2-yl]-5-fluoro-1H-pyridin-2-one.
What is the SMILES notation for 3-[(2S)-1,1-difluoropropan-2-yl]-5-fluoro-1H-pyridin-2-one?
The canonical SMILES for 3-[(2S)-1,1-difluoropropan-2-yl]-5-fluoro-1H-pyridin-2-one is C[C@@H](c1cc(F)c[nH]c1=O)C(F)F.
What is the InChIKey of 3-[(2S)-1,1-difluoropropan-2-yl]-5-fluoro-1H-pyridin-2-one?
The InChIKey is BMCQKJSXEBSKMO-BYPYZUCNSA-N. The full InChI is InChI=1S/C8H8F3NO/c1-4(7(10)11)6-2-5(9)3-12-8(6)13/h2-4,7H,1H3,(H,12,13)/t4-/m0/s1.
What are the key properties of 3-[(2S)-1,1-difluoropropan-2-yl]-5-fluoro-1H-pyridin-2-one?
3-[(2S)-1,1-difluoropropan-2-yl]-5-fluoro-1H-pyridin-2-one has a molecular weight of 191.15 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S)-1,1-difluoropropan-2-yl]-5-fluoro-1H-pyridin-2-one is sourced from PubChem (CID 168935765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).