C11H11FN4O3 — CID 168936037
1-[1-(5-fluoro-2-methoxy-3-pyridinyl)ethyl]triazole-4-carboxylic acid (PubChem CID 168936037) has the molecular formula C11H11FN4O3 and a molecular weight of 266.23 g/mol. Its IUPAC name is 1-[1-(5-fluoro-2-methoxy-3-pyridinyl)ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[1-(5-fluoro-2-methoxy-3-pyridinyl)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 168936037 |
| Molecular Formula | C11H11FN4O3 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 1-[1-(5-fluoro-2-methoxy-3-pyridinyl)ethyl]triazole-4-carboxylic acid |
| SMILES | COc1ncc(F)cc1C(C)n1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C11H11FN4O3/c1-6(16-5-9(11(17)18)14-15-16)8-3-7(12)4-13-10(8)19-2/h3-6H,1-2H3,(H,17,18) |
| InChIKey | UCXQFBDFGRXGJK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |