C22H32N3O5+ — CID 168936712
4-amino-1-[5-(3-cyclobutyl-3-oxopropyl)oxolan-2-yl]-1-methylpyrimidin-1-ium-2-one;(2Z)-4-methylpenta-2,4-dienoic acid (PubChem CID 168936712) has the molecular formula C22H32N3O5+ and a molecular weight of 418.51 g/mol. Its IUPAC name is 4-amino-1-[5-(3-cyclobutyl-3-oxopropyl)oxolan-2-yl]-1-methylpyrimidin-1-ium-2-one;(2Z)-4-methylpenta-2,4-dienoic acid.
| Compound Name | 4-amino-1-[5-(3-cyclobutyl-3-oxopropyl)oxolan-2-yl]-1-methylpyrimidin-1-ium-2-one;(2Z)-4-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 168936712 |
| Molecular Formula | C22H32N3O5+ |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 4-amino-1-[5-(3-cyclobutyl-3-oxopropyl)oxolan-2-yl]-1-methylpyrimidin-1-ium-2-one;(2Z)-4-methylpenta-2,4-dienoic acid |
| SMILES | C=C(C)/C=C\C(=O)O.C[N+]1(C2CCC(CCC(=O)C3CCC3)O2)C=CC(N)=NC1=O |
| InChI | InChI=1S/C16H23N3O3.C6H8O2/c1-19(10-9-14(17)18-16(19)21)15-8-6-12(22-15)5-7-13(20)11-3-2-4-11;1-5(2)3-4-6(7)8/h9-12,15H,2-8H2,1H3,(H-,17,18,21);3-4H,1H2,2H3,(H,7,8)/p+1/b;4-3- |
| InChIKey | TXXIEVMSROQBNY-QGAMPUOQSA-O |
| XLogP | 3.30 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|