C21H29FN6 — CID 168936858
N-[[3-[(Z)-but-1-enyl]imino-6-fluoro-4-iminocyclohexa-1,5-dien-1-yl]methyl]-4-(3-methylpiperazin-1-yl)-1,2-dihydropyridin-5-amine (PubChem CID 168936858) has the molecular formula C21H29FN6 and a molecular weight of 384.50 g/mol. Its IUPAC name is N-[[3-[(Z)-but-1-enyl]imino-6-fluoro-4-iminocyclohexa-1,5-dien-1-yl]methyl]-4-(3-methylpiperazin-1-yl)-1,2-dihydropyridin-5-amine.
| Compound Name | N-[[3-[(Z)-but-1-enyl]imino-6-fluoro-4-iminocyclohexa-1,5-dien-1-yl]methyl]-4-(3-methylpiperazin-1-yl)-1,2-dihydropyridin-5-amine |
|---|---|
| PubChem CID | 168936858 |
| Molecular Formula | C21H29FN6 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | N-[[3-[(Z)-but-1-enyl]imino-6-fluoro-4-iminocyclohexa-1,5-dien-1-yl]methyl]-4-(3-methylpiperazin-1-yl)-1,2-dihydropyridin-5-amine |
| SMILES | [H]/N=C1\C=C(F)C(CNC2=CNCC=C2N2CCNC(C)C2)=C\C1=N/C=C\CC |
| InChI | InChI=1S/C21H29FN6/c1-3-4-6-26-19-10-16(17(22)11-18(19)23)12-27-20-13-24-7-5-21(20)28-9-8-25-15(2)14-28/h4-6,10-11,13,15,23-25,27H,3,7-9,12,14H2,1-2H3/b6-4-,23-18+,26-19+ |
| InChIKey | QQJDQIFBAFVQKM-CELGPRDFSA-N |
| XLogP | 2.38 |
| TPSA | 75.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|