C18H21N6P — CID 168937037
2-phosphanyl-4-piperazin-1-yl-N-(quinoxalin-6-ylmethyl)pyridin-3-amine (PubChem CID 168937037) has the molecular formula C18H21N6P and a molecular weight of 352.38 g/mol. Its IUPAC name is 2-phosphanyl-4-piperazin-1-yl-N-(quinoxalin-6-ylmethyl)pyridin-3-amine.
| Compound Name | 2-phosphanyl-4-piperazin-1-yl-N-(quinoxalin-6-ylmethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 168937037 |
| Molecular Formula | C18H21N6P |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-phosphanyl-4-piperazin-1-yl-N-(quinoxalin-6-ylmethyl)pyridin-3-amine |
| SMILES | Pc1nccc(N2CCNCC2)c1NCc1ccc2nccnc2c1 |
| InChI | InChI=1S/C18H21N6P/c25-18-17(16(3-4-22-18)24-9-7-19-8-10-24)23-12-13-1-2-14-15(11-13)21-6-5-20-14/h1-6,11,19,23H,7-10,12,25H2 |
| InChIKey | FSTPADBRVYGUMX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|