C28H41FN4 — CID 168937126
(2E,4E)-N-[[(4Z)-4-butylidene-5-fluoro-3-[(Z)-prop-1-enyl]iminocyclohexa-1,5-dien-1-yl]methyl]-7-methyl-4-piperazin-1-ylnona-2,4,6-trien-3-amine (PubChem CID 168937126) has the molecular formula C28H41FN4 and a molecular weight of 452.66 g/mol. Its IUPAC name is (2E,4E)-N-[[(4Z)-4-butylidene-5-fluoro-3-[(Z)-prop-1-enyl]iminocyclohexa-1,5-dien-1-yl]methyl]-7-methyl-4-piperazin-1-ylnona-2,4,6-trien-3-amine.
| Compound Name | (2E,4E)-N-[[(4Z)-4-butylidene-5-fluoro-3-[(Z)-prop-1-enyl]iminocyclohexa-1,5-dien-1-yl]methyl]-7-methyl-4-piperazin-1-ylnona-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 168937126 |
| Molecular Formula | C28H41FN4 |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | (2E,4E)-N-[[(4Z)-4-butylidene-5-fluoro-3-[(Z)-prop-1-enyl]iminocyclohexa-1,5-dien-1-yl]methyl]-7-methyl-4-piperazin-1-ylnona-2,4,6-trien-3-amine |
| SMILES | C/C=C\N=C1/C=C(CNC(=C/C)/C(=C\C=C(C)CC)N2CCNCC2)C=C(F)/C1=C\CCC |
| InChI | InChI=1S/C28H41FN4/c1-6-10-11-24-25(29)19-23(20-27(24)31-14-7-2)21-32-26(9-4)28(13-12-22(5)8-3)33-17-15-30-16-18-33/h7,9,11-14,19-20,30,32H,6,8,10,15-18,21H2,1-5H3/b14-7-,22-12?,24-11+,26-9+,28-13+,31-27+ |
| InChIKey | UVDZWFKMWICPAL-KGOUBYFOSA-N |
| XLogP | 6.12 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|