C21H20N2O4 — CID 168937798
methyl 3-[(3-hydroxy-5-naphthalen-2-ylpyridine-2-carbonyl)amino]-2-methylpropanoate (PubChem CID 168937798) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is methyl 3-[(3-hydroxy-5-naphthalen-2-ylpyridine-2-carbonyl)amino]-2-methylpropanoate.
| Compound Name | methyl 3-[(3-hydroxy-5-naphthalen-2-ylpyridine-2-carbonyl)amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 168937798 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | methyl 3-[(3-hydroxy-5-naphthalen-2-ylpyridine-2-carbonyl)amino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)CNC(=O)c1ncc(-c2ccc3ccccc3c2)cc1O |
| InChI | InChI=1S/C21H20N2O4/c1-13(21(26)27-2)11-23-20(25)19-18(24)10-17(12-22-19)16-8-7-14-5-3-4-6-15(14)9-16/h3-10,12-13,24H,11H2,1-2H3,(H,23,25) |
| InChIKey | IFGJJXIJEDJLRC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |