About N-tert-butyl-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide
N-tert-butyl-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide (PubChem CID 168938283) has the molecular formula C14H20N2O
and a molecular weight of 232.33 g/mol. Its IUPAC name is N-tert-butyl-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide |
| PubChem CID | 168938283 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | N-tert-butyl-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide |
| SMILES | Cc1nc2c(cc1C(=O)NC(C)(C)C)CCC2 |
| InChI | InChI=1S/C14H20N2O/c1-9-11(13(17)16-14(2,3)4)8-10-6-5-7-12(10)15-9/h8H,5-7H2,1-4H3,(H,16,17) |
| InChIKey | FFVJKLQBMIRHHH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-tert-butyl-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide?
The IUPAC name of N-tert-butyl-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide (CID 168938283) is N-tert-butyl-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide.
What is the SMILES notation for N-tert-butyl-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide?
The canonical SMILES for N-tert-butyl-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide is Cc1nc2c(cc1C(=O)NC(C)(C)C)CCC2.
What is the InChIKey of N-tert-butyl-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide?
The InChIKey is FFVJKLQBMIRHHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O/c1-9-11(13(17)16-14(2,3)4)8-10-6-5-7-12(10)15-9/h8H,5-7H2,1-4H3,(H,16,17).
What are the key properties of N-tert-butyl-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide?
N-tert-butyl-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide has a molecular weight of 232.33 g/mol, XLogP of 2.41, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide is sourced from PubChem (CID 168938283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).