About 8-hydroxy-1-(4,4,4-trifluorobutyl)-4-(trifluoromethyl)quinolin-2-one
8-hydroxy-1-(4,4,4-trifluorobutyl)-4-(trifluoromethyl)quinolin-2-one (PubChem CID 168938327) has the molecular formula C14H11F6NO2
and a molecular weight of 339.24 g/mol. Its IUPAC name is 8-hydroxy-1-(4,4,4-trifluorobutyl)-4-(trifluoromethyl)quinolin-2-one.
Molecular Properties
| Compound Name | 8-hydroxy-1-(4,4,4-trifluorobutyl)-4-(trifluoromethyl)quinolin-2-one |
| PubChem CID | 168938327 |
| Molecular Formula | C14H11F6NO2 |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 8-hydroxy-1-(4,4,4-trifluorobutyl)-4-(trifluoromethyl)quinolin-2-one |
| SMILES | O=c1cc(C(F)(F)F)c2cccc(O)c2n1CCCC(F)(F)F |
| InChI | InChI=1S/C14H11F6NO2/c15-13(16,17)5-2-6-21-11(23)7-9(14(18,19)20)8-3-1-4-10(22)12(8)21/h1,3-4,7,22H,2,5-6H2 |
| InChIKey | VCXKVCNPASTJMJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-hydroxy-1-(4,4,4-trifluorobutyl)-4-(trifluoromethyl)quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxy-1-(4,4,4-trifluorobutyl)-4-(trifluoromethyl)quinolin-2-one?
The IUPAC name of 8-hydroxy-1-(4,4,4-trifluorobutyl)-4-(trifluoromethyl)quinolin-2-one (CID 168938327) is 8-hydroxy-1-(4,4,4-trifluorobutyl)-4-(trifluoromethyl)quinolin-2-one.
What is the SMILES notation for 8-hydroxy-1-(4,4,4-trifluorobutyl)-4-(trifluoromethyl)quinolin-2-one?
The canonical SMILES for 8-hydroxy-1-(4,4,4-trifluorobutyl)-4-(trifluoromethyl)quinolin-2-one is O=c1cc(C(F)(F)F)c2cccc(O)c2n1CCCC(F)(F)F.
What is the InChIKey of 8-hydroxy-1-(4,4,4-trifluorobutyl)-4-(trifluoromethyl)quinolin-2-one?
The InChIKey is VCXKVCNPASTJMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F6NO2/c15-13(16,17)5-2-6-21-11(23)7-9(14(18,19)20)8-3-1-4-10(22)12(8)21/h1,3-4,7,22H,2,5-6H2.
What are the key properties of 8-hydroxy-1-(4,4,4-trifluorobutyl)-4-(trifluoromethyl)quinolin-2-one?
8-hydroxy-1-(4,4,4-trifluorobutyl)-4-(trifluoromethyl)quinolin-2-one has a molecular weight of 339.24 g/mol, XLogP of 4.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-1-(4,4,4-trifluorobutyl)-4-(trifluoromethyl)quinolin-2-one is sourced from PubChem (CID 168938327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).