About 2-bromo-6-methylpyrazine;ethane
2-bromo-6-methylpyrazine;ethane (PubChem CID 168939100) has the molecular formula C7H11BrN2
and a molecular weight of 203.08 g/mol. Its IUPAC name is 2-bromo-6-methylpyrazine;ethane.
Molecular Properties
| Compound Name | 2-bromo-6-methylpyrazine;ethane |
| PubChem CID | 168939100 |
| Molecular Formula | C7H11BrN2 |
| Molecular Weight | 203.08 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | 2-bromo-6-methylpyrazine;ethane |
| SMILES | CC.Cc1cncc(Br)n1 |
| InChI | InChI=1S/C5H5BrN2.C2H6/c1-4-2-7-3-5(6)8-4;1-2/h2-3H,1H3;1-2H3 |
| InChIKey | QMGYBRWLNDCBAQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.08 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-6-methylpyrazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-methylpyrazine;ethane?
The IUPAC name of 2-bromo-6-methylpyrazine;ethane (CID 168939100) is 2-bromo-6-methylpyrazine;ethane.
What is the SMILES notation for 2-bromo-6-methylpyrazine;ethane?
The canonical SMILES for 2-bromo-6-methylpyrazine;ethane is CC.Cc1cncc(Br)n1.
What is the InChIKey of 2-bromo-6-methylpyrazine;ethane?
The InChIKey is QMGYBRWLNDCBAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5BrN2.C2H6/c1-4-2-7-3-5(6)8-4;1-2/h2-3H,1H3;1-2H3.
What are the key properties of 2-bromo-6-methylpyrazine;ethane?
2-bromo-6-methylpyrazine;ethane has a molecular weight of 203.08 g/mol, XLogP of 2.57, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-methylpyrazine;ethane is sourced from PubChem (CID 168939100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).