About 4-chloro-3-methyl-1-(2,2,2-trifluoroethyl)pyrazole;ethane
4-chloro-3-methyl-1-(2,2,2-trifluoroethyl)pyrazole;ethane (PubChem CID 168939220) has the molecular formula C8H12ClF3N2
and a molecular weight of 228.65 g/mol. Its IUPAC name is 4-chloro-3-methyl-1-(2,2,2-trifluoroethyl)pyrazole;ethane.
Molecular Properties
| Compound Name | 4-chloro-3-methyl-1-(2,2,2-trifluoroethyl)pyrazole;ethane |
| PubChem CID | 168939220 |
| Molecular Formula | C8H12ClF3N2 |
| Molecular Weight | 228.65 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 4-chloro-3-methyl-1-(2,2,2-trifluoroethyl)pyrazole;ethane |
| SMILES | CC.Cc1nn(CC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C6H6ClF3N2.C2H6/c1-4-5(7)2-12(11-4)3-6(8,9)10;1-2/h2H,3H2,1H3;1-2H3 |
| InChIKey | CKLKDKWFSYOXOI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.65 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-3-methyl-1-(2,2,2-trifluoroethyl)pyrazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-methyl-1-(2,2,2-trifluoroethyl)pyrazole;ethane?
The IUPAC name of 4-chloro-3-methyl-1-(2,2,2-trifluoroethyl)pyrazole;ethane (CID 168939220) is 4-chloro-3-methyl-1-(2,2,2-trifluoroethyl)pyrazole;ethane.
What is the SMILES notation for 4-chloro-3-methyl-1-(2,2,2-trifluoroethyl)pyrazole;ethane?
The canonical SMILES for 4-chloro-3-methyl-1-(2,2,2-trifluoroethyl)pyrazole;ethane is CC.Cc1nn(CC(F)(F)F)cc1Cl.
What is the InChIKey of 4-chloro-3-methyl-1-(2,2,2-trifluoroethyl)pyrazole;ethane?
The InChIKey is CKLKDKWFSYOXOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClF3N2.C2H6/c1-4-5(7)2-12(11-4)3-6(8,9)10;1-2/h2H,3H2,1H3;1-2H3.
What are the key properties of 4-chloro-3-methyl-1-(2,2,2-trifluoroethyl)pyrazole;ethane?
4-chloro-3-methyl-1-(2,2,2-trifluoroethyl)pyrazole;ethane has a molecular weight of 228.65 g/mol, XLogP of 3.43, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-methyl-1-(2,2,2-trifluoroethyl)pyrazole;ethane is sourced from PubChem (CID 168939220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).