About 4-fluoro-1-(1-propan-2-ylpyrrolidin-3-yl)-5,6-dihydroindole
4-fluoro-1-(1-propan-2-ylpyrrolidin-3-yl)-5,6-dihydroindole (PubChem CID 168939762) has the molecular formula C15H21FN2
and a molecular weight of 248.34 g/mol. Its IUPAC name is 4-fluoro-1-(1-propan-2-ylpyrrolidin-3-yl)-5,6-dihydroindole.
Molecular Properties
| Compound Name | 4-fluoro-1-(1-propan-2-ylpyrrolidin-3-yl)-5,6-dihydroindole |
| PubChem CID | 168939762 |
| Molecular Formula | C15H21FN2 |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 4-fluoro-1-(1-propan-2-ylpyrrolidin-3-yl)-5,6-dihydroindole |
| SMILES | CC(C)N1CCC(n2ccc3c2=CCCC=3F)C1 |
| InChI | InChI=1S/C15H21FN2/c1-11(2)17-8-6-12(10-17)18-9-7-13-14(16)4-3-5-15(13)18/h5,7,9,11-12H,3-4,6,8,10H2,1-2H3 |
| InChIKey | NYIWKGVCEKSHIW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-1-(1-propan-2-ylpyrrolidin-3-yl)-5,6-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1-(1-propan-2-ylpyrrolidin-3-yl)-5,6-dihydroindole?
The IUPAC name of 4-fluoro-1-(1-propan-2-ylpyrrolidin-3-yl)-5,6-dihydroindole (CID 168939762) is 4-fluoro-1-(1-propan-2-ylpyrrolidin-3-yl)-5,6-dihydroindole.
What is the SMILES notation for 4-fluoro-1-(1-propan-2-ylpyrrolidin-3-yl)-5,6-dihydroindole?
The canonical SMILES for 4-fluoro-1-(1-propan-2-ylpyrrolidin-3-yl)-5,6-dihydroindole is CC(C)N1CCC(n2ccc3c2=CCCC=3F)C1.
What is the InChIKey of 4-fluoro-1-(1-propan-2-ylpyrrolidin-3-yl)-5,6-dihydroindole?
The InChIKey is NYIWKGVCEKSHIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21FN2/c1-11(2)17-8-6-12(10-17)18-9-7-13-14(16)4-3-5-15(13)18/h5,7,9,11-12H,3-4,6,8,10H2,1-2H3.
What are the key properties of 4-fluoro-1-(1-propan-2-ylpyrrolidin-3-yl)-5,6-dihydroindole?
4-fluoro-1-(1-propan-2-ylpyrrolidin-3-yl)-5,6-dihydroindole has a molecular weight of 248.34 g/mol, XLogP of 1.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1-(1-propan-2-ylpyrrolidin-3-yl)-5,6-dihydroindole is sourced from PubChem (CID 168939762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).