About 1-(azetidin-3-yl)-2,3-dimethylidenepyrrole
1-(azetidin-3-yl)-2,3-dimethylidenepyrrole (PubChem CID 168939763) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-2,3-dimethylidenepyrrole.
Molecular Properties
| Compound Name | 1-(azetidin-3-yl)-2,3-dimethylidenepyrrole |
| PubChem CID | 168939763 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 1-(azetidin-3-yl)-2,3-dimethylidenepyrrole |
| SMILES | C=c1ccn(C2CNC2)c1=C |
| InChI | InChI=1S/C9H12N2/c1-7-3-4-11(8(7)2)9-5-10-6-9/h3-4,9-10H,1-2,5-6H2 |
| InChIKey | GZTMZYKKIUPWEW-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(azetidin-3-yl)-2,3-dimethylidenepyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azetidin-3-yl)-2,3-dimethylidenepyrrole?
The IUPAC name of 1-(azetidin-3-yl)-2,3-dimethylidenepyrrole (CID 168939763) is 1-(azetidin-3-yl)-2,3-dimethylidenepyrrole.
What is the SMILES notation for 1-(azetidin-3-yl)-2,3-dimethylidenepyrrole?
The canonical SMILES for 1-(azetidin-3-yl)-2,3-dimethylidenepyrrole is C=c1ccn(C2CNC2)c1=C.
What is the InChIKey of 1-(azetidin-3-yl)-2,3-dimethylidenepyrrole?
The InChIKey is GZTMZYKKIUPWEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-7-3-4-11(8(7)2)9-5-10-6-9/h3-4,9-10H,1-2,5-6H2.
What are the key properties of 1-(azetidin-3-yl)-2,3-dimethylidenepyrrole?
1-(azetidin-3-yl)-2,3-dimethylidenepyrrole has a molecular weight of 148.21 g/mol, XLogP of -0.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azetidin-3-yl)-2,3-dimethylidenepyrrole is sourced from PubChem (CID 168939763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).