About 3-bromo-N,N-dimethyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide
3-bromo-N,N-dimethyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide (PubChem CID 168940806) has the molecular formula C12H15BrN2O3S
and a molecular weight of 347.23 g/mol. Its IUPAC name is 3-bromo-N,N-dimethyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-bromo-N,N-dimethyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide |
| PubChem CID | 168940806 |
| Molecular Formula | C12H15BrN2O3S |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 3-bromo-N,N-dimethyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(N2CCCC2=O)c(Br)c1 |
| InChI | InChI=1S/C12H15BrN2O3S/c1-14(2)19(17,18)9-5-6-11(10(13)8-9)15-7-3-4-12(15)16/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | OGZXHGQTAANKCE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-N,N-dimethyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N,N-dimethyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide?
The IUPAC name of 3-bromo-N,N-dimethyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide (CID 168940806) is 3-bromo-N,N-dimethyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide.
What is the SMILES notation for 3-bromo-N,N-dimethyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide?
The canonical SMILES for 3-bromo-N,N-dimethyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide is CN(C)S(=O)(=O)c1ccc(N2CCCC2=O)c(Br)c1.
What is the InChIKey of 3-bromo-N,N-dimethyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide?
The InChIKey is OGZXHGQTAANKCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrN2O3S/c1-14(2)19(17,18)9-5-6-11(10(13)8-9)15-7-3-4-12(15)16/h5-6,8H,3-4,7H2,1-2H3.
What are the key properties of 3-bromo-N,N-dimethyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide?
3-bromo-N,N-dimethyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide has a molecular weight of 347.23 g/mol, XLogP of 1.83, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N,N-dimethyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide is sourced from PubChem (CID 168940806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).