C7H13BN2O — CID 168941428
CID 168941428 (PubChem CID 168941428) has the molecular formula C7H13BN2O and a molecular weight of 152.01 g/mol.
| Compound Name | CID 168941428 |
|---|---|
| PubChem CID | 168941428 |
| Molecular Formula | C7H13BN2O |
| Molecular Weight | 152.01 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | — |
| SMILES | [B]C1CCN(C(=O)CNC)C1 |
| InChI | InChI=1S/C7H13BN2O/c1-9-4-7(11)10-3-2-6(8)5-10/h6,9H,2-5H2,1H3 |
| InChIKey | SETCDUDSNUCRGO-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.01 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|