About 2-[amino-(1-methyl-2,5-dihydropyrrol-3-yl)methyl]-6-chloroaniline
2-[amino-(1-methyl-2,5-dihydropyrrol-3-yl)methyl]-6-chloroaniline (PubChem CID 168941492) has the molecular formula C12H16ClN3
and a molecular weight of 237.73 g/mol. Its IUPAC name is 2-[amino-(1-methyl-2,5-dihydropyrrol-3-yl)methyl]-6-chloroaniline.
Molecular Properties
| Compound Name | 2-[amino-(1-methyl-2,5-dihydropyrrol-3-yl)methyl]-6-chloroaniline |
| PubChem CID | 168941492 |
| Molecular Formula | C12H16ClN3 |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-[amino-(1-methyl-2,5-dihydropyrrol-3-yl)methyl]-6-chloroaniline |
| SMILES | CN1CC=C(C(N)c2cccc(Cl)c2N)C1 |
| InChI | InChI=1S/C12H16ClN3/c1-16-6-5-8(7-16)11(14)9-3-2-4-10(13)12(9)15/h2-5,11H,6-7,14-15H2,1H3 |
| InChIKey | WLBPPKQNVYYBLP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[amino-(1-methyl-2,5-dihydropyrrol-3-yl)methyl]-6-chloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[amino-(1-methyl-2,5-dihydropyrrol-3-yl)methyl]-6-chloroaniline?
The IUPAC name of 2-[amino-(1-methyl-2,5-dihydropyrrol-3-yl)methyl]-6-chloroaniline (CID 168941492) is 2-[amino-(1-methyl-2,5-dihydropyrrol-3-yl)methyl]-6-chloroaniline.
What is the SMILES notation for 2-[amino-(1-methyl-2,5-dihydropyrrol-3-yl)methyl]-6-chloroaniline?
The canonical SMILES for 2-[amino-(1-methyl-2,5-dihydropyrrol-3-yl)methyl]-6-chloroaniline is CN1CC=C(C(N)c2cccc(Cl)c2N)C1.
What is the InChIKey of 2-[amino-(1-methyl-2,5-dihydropyrrol-3-yl)methyl]-6-chloroaniline?
The InChIKey is WLBPPKQNVYYBLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClN3/c1-16-6-5-8(7-16)11(14)9-3-2-4-10(13)12(9)15/h2-5,11H,6-7,14-15H2,1H3.
What are the key properties of 2-[amino-(1-methyl-2,5-dihydropyrrol-3-yl)methyl]-6-chloroaniline?
2-[amino-(1-methyl-2,5-dihydropyrrol-3-yl)methyl]-6-chloroaniline has a molecular weight of 237.73 g/mol, XLogP of 1.79, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[amino-(1-methyl-2,5-dihydropyrrol-3-yl)methyl]-6-chloroaniline is sourced from PubChem (CID 168941492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).