About 2-(2,4,6-trifluoroanilino)acetaldehyde
2-(2,4,6-trifluoroanilino)acetaldehyde (PubChem CID 168941947) has the molecular formula C8H6F3NO
and a molecular weight of 189.14 g/mol. Its IUPAC name is 2-(2,4,6-trifluoroanilino)acetaldehyde.
Molecular Properties
| Compound Name | 2-(2,4,6-trifluoroanilino)acetaldehyde |
| PubChem CID | 168941947 |
| Molecular Formula | C8H6F3NO |
| Molecular Weight | 189.14 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 2-(2,4,6-trifluoroanilino)acetaldehyde |
| SMILES | O=CCNc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C8H6F3NO/c9-5-3-6(10)8(7(11)4-5)12-1-2-13/h2-4,12H,1H2 |
| InChIKey | WSKPEAZQIVCKOA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.14 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4,6-trifluoroanilino)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4,6-trifluoroanilino)acetaldehyde?
The IUPAC name of 2-(2,4,6-trifluoroanilino)acetaldehyde (CID 168941947) is 2-(2,4,6-trifluoroanilino)acetaldehyde.
What is the SMILES notation for 2-(2,4,6-trifluoroanilino)acetaldehyde?
The canonical SMILES for 2-(2,4,6-trifluoroanilino)acetaldehyde is O=CCNc1c(F)cc(F)cc1F.
What is the InChIKey of 2-(2,4,6-trifluoroanilino)acetaldehyde?
The InChIKey is WSKPEAZQIVCKOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F3NO/c9-5-3-6(10)8(7(11)4-5)12-1-2-13/h2-4,12H,1H2.
What are the key properties of 2-(2,4,6-trifluoroanilino)acetaldehyde?
2-(2,4,6-trifluoroanilino)acetaldehyde has a molecular weight of 189.14 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4,6-trifluoroanilino)acetaldehyde is sourced from PubChem (CID 168941947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).