About 7-(3,3-difluoropyrrolidin-1-yl)-4-(2-methylphenyl)pyrano[2,3-b]pyridin-2-one
7-(3,3-difluoropyrrolidin-1-yl)-4-(2-methylphenyl)pyrano[2,3-b]pyridin-2-one (PubChem CID 168942069) has the molecular formula C19H16F2N2O2
and a molecular weight of 342.35 g/mol. Its IUPAC name is 7-(3,3-difluoropyrrolidin-1-yl)-4-(2-methylphenyl)pyrano[2,3-b]pyridin-2-one.
Molecular Properties
| Compound Name | 7-(3,3-difluoropyrrolidin-1-yl)-4-(2-methylphenyl)pyrano[2,3-b]pyridin-2-one |
| PubChem CID | 168942069 |
| Molecular Formula | C19H16F2N2O2 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 7-(3,3-difluoropyrrolidin-1-yl)-4-(2-methylphenyl)pyrano[2,3-b]pyridin-2-one |
| SMILES | Cc1ccccc1-c1cc(=O)oc2nc(N3CCC(F)(F)C3)ccc12 |
| InChI | InChI=1S/C19H16F2N2O2/c1-12-4-2-3-5-13(12)15-10-17(24)25-18-14(15)6-7-16(22-18)23-9-8-19(20,21)11-23/h2-7,10H,8-9,11H2,1H3 |
| InChIKey | OCKZQFKBYWFYTK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(3,3-difluoropyrrolidin-1-yl)-4-(2-methylphenyl)pyrano[2,3-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,3-difluoropyrrolidin-1-yl)-4-(2-methylphenyl)pyrano[2,3-b]pyridin-2-one?
The IUPAC name of 7-(3,3-difluoropyrrolidin-1-yl)-4-(2-methylphenyl)pyrano[2,3-b]pyridin-2-one (CID 168942069) is 7-(3,3-difluoropyrrolidin-1-yl)-4-(2-methylphenyl)pyrano[2,3-b]pyridin-2-one.
What is the SMILES notation for 7-(3,3-difluoropyrrolidin-1-yl)-4-(2-methylphenyl)pyrano[2,3-b]pyridin-2-one?
The canonical SMILES for 7-(3,3-difluoropyrrolidin-1-yl)-4-(2-methylphenyl)pyrano[2,3-b]pyridin-2-one is Cc1ccccc1-c1cc(=O)oc2nc(N3CCC(F)(F)C3)ccc12.
What is the InChIKey of 7-(3,3-difluoropyrrolidin-1-yl)-4-(2-methylphenyl)pyrano[2,3-b]pyridin-2-one?
The InChIKey is OCKZQFKBYWFYTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F2N2O2/c1-12-4-2-3-5-13(12)15-10-17(24)25-18-14(15)6-7-16(22-18)23-9-8-19(20,21)11-23/h2-7,10H,8-9,11H2,1H3.
What are the key properties of 7-(3,3-difluoropyrrolidin-1-yl)-4-(2-methylphenyl)pyrano[2,3-b]pyridin-2-one?
7-(3,3-difluoropyrrolidin-1-yl)-4-(2-methylphenyl)pyrano[2,3-b]pyridin-2-one has a molecular weight of 342.35 g/mol, XLogP of 4.01, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,3-difluoropyrrolidin-1-yl)-4-(2-methylphenyl)pyrano[2,3-b]pyridin-2-one is sourced from PubChem (CID 168942069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).