C9H17NO — CID 168942653
1-propan-2-yl-2,3,6,7-tetrahydroazepin-3-ol (PubChem CID 168942653) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is 1-propan-2-yl-2,3,6,7-tetrahydroazepin-3-ol.
| Compound Name | 1-propan-2-yl-2,3,6,7-tetrahydroazepin-3-ol |
|---|---|
| PubChem CID | 168942653 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 1-propan-2-yl-2,3,6,7-tetrahydroazepin-3-ol |
| SMILES | CC(C)N1CCC=CC(O)C1 |
| InChI | InChI=1S/C9H17NO/c1-8(2)10-6-4-3-5-9(11)7-10/h3,5,8-9,11H,4,6-7H2,1-2H3 |
| InChIKey | GGMJFBYFLDKBEG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|